C14H21N5 — CID 114536202
2-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-methylpyridine-2,5-diamine (PubChem CID 114536202) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-methylpyridine-2,5-diamine.
| Compound Name | 2-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 114536202 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-methylpyridine-2,5-diamine |
| SMILES | Cc1cc(C)n(CCCNc2cc(C)c(N)cn2)n1 |
| InChI | InChI=1S/C14H21N5/c1-10-7-14(17-9-13(10)15)16-5-4-6-19-12(3)8-11(2)18-19/h7-9H,4-6,15H2,1-3H3,(H,16,17) |
| InChIKey | QJLQSMOTOOLQTJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|