C15H18ClN3O2 — CID 114541167
3-chloro-4-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzoic acid (PubChem CID 114541167) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 3-chloro-4-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzoic acid.
| Compound Name | 3-chloro-4-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzoic acid |
|---|---|
| PubChem CID | 114541167 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-chloro-4-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzoic acid |
| SMILES | Cc1cc(C)n(CCCNc2ccc(C(=O)O)cc2Cl)n1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-10-8-11(2)19(18-10)7-3-6-17-14-5-4-12(15(20)21)9-13(14)16/h4-5,8-9,17H,3,6-7H2,1-2H3,(H,20,21) |
| InChIKey | VMVWMWKNGGNJLQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|