C14H18N4O2 — CID 114537284
4-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyridine-2-carboxylic acid (PubChem CID 114537284) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyridine-2-carboxylic acid.
| Compound Name | 4-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114537284 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc(C)n(CCCNc2ccnc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C14H18N4O2/c1-10-8-11(2)18(17-10)7-3-5-15-12-4-6-16-13(9-12)14(19)20/h4,6,8-9H,3,5,7H2,1-2H3,(H,15,16)(H,19,20) |
| InChIKey | XEIJIDANDXCFKA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|