C13H16N4O3S — CID 114539271
2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 114539271) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114539271 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2nc(C(=O)O)cs2)n1 |
| InChI | InChI=1S/C13H16N4O3S/c1-8-6-9(2)17(16-8)5-3-4-14-11(18)12-15-10(7-21-12)13(19)20/h6-7H,3-5H2,1-2H3,(H,14,18)(H,19,20) |
| InChIKey | WDSAPLWERLNAAG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|