C7H13N3O — CID 122626197
N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]hydroxylamine (PubChem CID 122626197) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]hydroxylamine.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 122626197 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]hydroxylamine |
| SMILES | Cc1cc(C)n(CCNO)n1 |
| InChI | InChI=1S/C7H13N3O/c1-6-5-7(2)10(9-6)4-3-8-11/h5,8,11H,3-4H2,1-2H3 |
| InChIKey | VJSQNRHACGYDBR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|