C9H16N2OS — CID 12074287
2-[2-(3,5-dimethylpyrazol-1-yl)ethylsulfanyl]ethanol (PubChem CID 12074287) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpyrazol-1-yl)ethylsulfanyl]ethanol.
| Compound Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethylsulfanyl]ethanol |
|---|---|
| PubChem CID | 12074287 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethylsulfanyl]ethanol |
| SMILES | Cc1cc(C)n(CCSCCO)n1 |
| InChI | InChI=1S/C9H16N2OS/c1-8-7-9(2)11(10-8)3-5-13-6-4-12/h7,12H,3-6H2,1-2H3 |
| InChIKey | HBNBSNJKMCMGNL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|