C11H21N3O2 — CID 115569666
3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]propane-1,2-diol (PubChem CID 115569666) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]propane-1,2-diol.
| Compound Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 115569666 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]propane-1,2-diol |
| SMILES | Cc1cc(C)n(CCCNCC(O)CO)n1 |
| InChI | InChI=1S/C11H21N3O2/c1-9-6-10(2)14(13-9)5-3-4-12-7-11(16)8-15/h6,11-12,15-16H,3-5,7-8H2,1-2H3 |
| InChIKey | PUTBCYPUOJLQQF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|