C24H29N3O3 — CID 2126667
[4-[(2R)-3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-hydroxypropoxy]phenyl]-phenylmethanone (PubChem CID 2126667) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is [4-[(2R)-3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-hydroxypropoxy]phenyl]-phenylmethanone.
| Compound Name | [4-[(2R)-3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-hydroxypropoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 2126667 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | [4-[(2R)-3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-hydroxypropoxy]phenyl]-phenylmethanone |
| SMILES | Cc1cc(C)n(CCCNC[C@@H](O)COc2ccc(C(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C24H29N3O3/c1-18-15-19(2)27(26-18)14-6-13-25-16-22(28)17-30-23-11-9-21(10-12-23)24(29)20-7-4-3-5-8-20/h3-5,7-12,15,22,25,28H,6,13-14,16-17H2,1-2H3/t22-/m1/s1 |
| InChIKey | VXHJFVNXLDLQBY-JOCHJYFZSA-N |
| XLogP | 3.15 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|