C12H23N3O — CID 114536486
3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-methylpropan-1-ol (PubChem CID 114536486) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-methylpropan-1-ol.
| Compound Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 114536486 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-methylpropan-1-ol |
| SMILES | Cc1cc(C)n(CCCNCC(C)CO)n1 |
| InChI | InChI=1S/C12H23N3O/c1-10(9-16)8-13-5-4-6-15-12(3)7-11(2)14-15/h7,10,13,16H,4-6,8-9H2,1-3H3 |
| InChIKey | BFAKUJTUQVWERG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|