C17H33N3 — CID 115706653
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2,6-dimethylheptan-4-amine (PubChem CID 115706653) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2,6-dimethylheptan-4-amine.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2,6-dimethylheptan-4-amine |
|---|---|
| PubChem CID | 115706653 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2,6-dimethylheptan-4-amine |
| SMILES | Cc1cc(C)n(CCCNC(CC(C)C)CC(C)C)n1 |
| InChI | InChI=1S/C17H33N3/c1-13(2)10-17(11-14(3)4)18-8-7-9-20-16(6)12-15(5)19-20/h12-14,17-18H,7-11H2,1-6H3 |
| InChIKey | IKFKUMIXYPEHOS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|