C17H25N3O — CID 104581513
2-[1-[3-(3,5-dimethylpyrazol-1-yl)propylamino]ethyl]-5-methylphenol (PubChem CID 104581513) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-[1-[3-(3,5-dimethylpyrazol-1-yl)propylamino]ethyl]-5-methylphenol.
| Compound Name | 2-[1-[3-(3,5-dimethylpyrazol-1-yl)propylamino]ethyl]-5-methylphenol |
|---|---|
| PubChem CID | 104581513 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-[1-[3-(3,5-dimethylpyrazol-1-yl)propylamino]ethyl]-5-methylphenol |
| SMILES | Cc1ccc(C(C)NCCCn2nc(C)cc2C)c(O)c1 |
| InChI | InChI=1S/C17H25N3O/c1-12-6-7-16(17(21)10-12)15(4)18-8-5-9-20-14(3)11-13(2)19-20/h6-7,10-11,15,18,21H,5,8-9H2,1-4H3 |
| InChIKey | WFNCDZCYYQAGPV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|