C21H31N3O3 — CID 2089105
4-[4-[(2R)-3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-hydroxypropoxy]phenyl]butan-2-one (PubChem CID 2089105) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-[4-[(2R)-3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-hydroxypropoxy]phenyl]butan-2-one.
| Compound Name | 4-[4-[(2R)-3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-hydroxypropoxy]phenyl]butan-2-one |
|---|---|
| PubChem CID | 2089105 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 4-[4-[(2R)-3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-hydroxypropoxy]phenyl]butan-2-one |
| SMILES | CC(=O)CCc1ccc(OC[C@H](O)CNCCCn2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H31N3O3/c1-16-13-17(2)24(23-16)12-4-11-22-14-20(26)15-27-21-9-7-19(8-10-21)6-5-18(3)25/h7-10,13,20,22,26H,4-6,11-12,14-15H2,1-3H3/t20-/m1/s1 |
| InChIKey | QHUPJBOZISRDPG-HXUWFJFHSA-N |
| XLogP | 2.44 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|