C9H14N4 — CID 63029530
2-amino-4-(3,5-dimethylpyrazol-1-yl)butanenitrile (PubChem CID 63029530) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-amino-4-(3,5-dimethylpyrazol-1-yl)butanenitrile.
| Compound Name | 2-amino-4-(3,5-dimethylpyrazol-1-yl)butanenitrile |
|---|---|
| PubChem CID | 63029530 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-amino-4-(3,5-dimethylpyrazol-1-yl)butanenitrile |
| SMILES | Cc1cc(C)n(CCC(N)C#N)n1 |
| InChI | InChI=1S/C9H14N4/c1-7-5-8(2)13(12-7)4-3-9(11)6-10/h5,9H,3-4,11H2,1-2H3 |
| InChIKey | DSFRGAZAOWUZRJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |