C8H14N2O2S — CID 63810790
3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazole (PubChem CID 63810790) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazole.
| Compound Name | 3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazole |
|---|---|
| PubChem CID | 63810790 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazole |
| SMILES | Cc1cc(C)n(CCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C8H14N2O2S/c1-7-6-8(2)10(9-7)4-5-13(3,11)12/h6H,4-5H2,1-3H3 |
| InChIKey | RPBXVMAUUMACKC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |