C9H16N2O — CID 15154386
1-(2-ethoxyethyl)-3,5-dimethylpyrazole (PubChem CID 15154386) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3,5-dimethylpyrazole.
| Compound Name | 1-(2-ethoxyethyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 15154386 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-(2-ethoxyethyl)-3,5-dimethylpyrazole |
| SMILES | CCOCCn1nc(C)cc1C |
| InChI | InChI=1S/C9H16N2O/c1-4-12-6-5-11-9(3)7-8(2)10-11/h7H,4-6H2,1-3H3 |
| InChIKey | NGUGAVJPOMDAIA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|