C12H20N2O2 — CID 134460631
2-(3,5-dimethylpyrazol-1-yl)ethyl 2-methylbutanoate (PubChem CID 134460631) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)ethyl 2-methylbutanoate.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 134460631 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCn1nc(C)cc1C |
| InChI | InChI=1S/C12H20N2O2/c1-5-9(2)12(15)16-7-6-14-11(4)8-10(3)13-14/h8-9H,5-7H2,1-4H3 |
| InChIKey | IZJBZRYCCVZWDS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |