methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate

C12H19N3O3 — CID 60727791

IUPACmethyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate
SMILESCOC(=O)C(C)NC(=O)CCn1nc(C)cc1C
InChIInChI=1S/C12H19N3O3/c1-8-7-9(2)15(14-8)6-5-11(16)13-10(3)12(17)18-4/h7,10H,5-6H2,1-4H3,(H,13,16)
InChIKeyRMKITSAUVYVIIS-UHFFFAOYSA-N
MW253.30 g/mol
LogP0.57
Rot. Bonds5

About methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate

methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate (PubChem CID 60727791) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate.

Molecular Properties

Compound Namemethyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate
PubChem CID60727791
Molecular FormulaC12H19N3O3
Molecular Weight253.30 g/mol
Exact Mass253.14
IUPAC Namemethyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate
SMILESCOC(=O)C(C)NC(=O)CCn1nc(C)cc1C
InChIInChI=1S/C12H19N3O3/c1-8-7-9(2)15(14-8)6-5-11(16)13-10(3)12(17)18-4/h7,10H,5-6H2,1-4H3,(H,13,16)
InChIKeyRMKITSAUVYVIIS-UHFFFAOYSA-N
XLogP0.57
TPSA73.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.30
LogP ≤ 50.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate?
The IUPAC name of methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate (CID 60727791) is methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate.
What is the SMILES notation for methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate?
The canonical SMILES for methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate is COC(=O)C(C)NC(=O)CCn1nc(C)cc1C.
What is the InChIKey of methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate?
The InChIKey is RMKITSAUVYVIIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-8-7-9(2)15(14-8)6-5-11(16)13-10(3)12(17)18-4/h7,10H,5-6H2,1-4H3,(H,13,16).
What are the key properties of methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate?
methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate has a molecular weight of 253.30 g/mol, XLogP of 0.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(3,5-dimethylpyrazol-1-yl)propanoylamino]propanoate is sourced from PubChem (CID 60727791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).