C11H19N3O2 — CID 43418241
3-(3,5-dimethylpyrazol-1-yl)-N-(2-hydroxypropyl)propanamide (PubChem CID 43418241) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-(2-hydroxypropyl)propanamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(2-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 43418241 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(2-hydroxypropyl)propanamide |
| SMILES | Cc1cc(C)n(CCC(=O)NCC(C)O)n1 |
| InChI | InChI=1S/C11H19N3O2/c1-8-6-9(2)14(13-8)5-4-11(16)12-7-10(3)15/h6,10,15H,4-5,7H2,1-3H3,(H,12,16) |
| InChIKey | YJIQSOZCVJIEMH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |