C24H27Cl2N3O — CID 69148477
N-[2,3-bis(4-chlorophenyl)butyl]-3-(3,5-dimethylpyrazol-1-yl)propanamide (PubChem CID 69148477) has the molecular formula C24H27Cl2N3O and a molecular weight of 444.41 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]-3-(3,5-dimethylpyrazol-1-yl)propanamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]-3-(3,5-dimethylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 69148477 |
| Molecular Formula | C24H27Cl2N3O |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]-3-(3,5-dimethylpyrazol-1-yl)propanamide |
| SMILES | Cc1cc(C)n(CCC(=O)NCC(c2ccc(Cl)cc2)C(C)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C24H27Cl2N3O/c1-16-14-17(2)29(28-16)13-12-24(30)27-15-23(20-6-10-22(26)11-7-20)18(3)19-4-8-21(25)9-5-19/h4-11,14,18,23H,12-13,15H2,1-3H3,(H,27,30) |
| InChIKey | WALPDQVNCIRCRG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |