C23H25Cl2N3O — CID 69148173
N-[2,3-bis(4-chlorophenyl)butyl]-2-(3,5-dimethylpyrazol-1-yl)acetamide (PubChem CID 69148173) has the molecular formula C23H25Cl2N3O and a molecular weight of 430.38 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]-2-(3,5-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]-2-(3,5-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 69148173 |
| Molecular Formula | C23H25Cl2N3O |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]-2-(3,5-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)NCC(c2ccc(Cl)cc2)C(C)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C23H25Cl2N3O/c1-15-12-16(2)28(27-15)14-23(29)26-13-22(19-6-10-21(25)11-7-19)17(3)18-4-8-20(24)9-5-18/h4-12,17,22H,13-14H2,1-3H3,(H,26,29) |
| InChIKey | SACAFBOVJIINBD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |