C22H23Cl2N3O — CID 69145430
N-[2,3-bis(4-chlorophenyl)butyl]-2-(5-methylpyrazol-1-yl)acetamide (PubChem CID 69145430) has the molecular formula C22H23Cl2N3O and a molecular weight of 416.35 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]-2-(5-methylpyrazol-1-yl)acetamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]-2-(5-methylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 69145430 |
| Molecular Formula | C22H23Cl2N3O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]-2-(5-methylpyrazol-1-yl)acetamide |
| SMILES | Cc1ccnn1CC(=O)NCC(c1ccc(Cl)cc1)C(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23Cl2N3O/c1-15-11-12-26-27(15)14-22(28)25-13-21(18-5-9-20(24)10-6-18)16(2)17-3-7-19(23)8-4-17/h3-12,16,21H,13-14H2,1-2H3,(H,25,28) |
| InChIKey | IXHWOBXBXXAHIF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |