C26H22Cl2N2O — CID 69377803
N-[2,3-bis(4-chlorophenyl)butyl]isoquinoline-8-carboxamide (PubChem CID 69377803) has the molecular formula C26H22Cl2N2O and a molecular weight of 449.38 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]isoquinoline-8-carboxamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 69377803 |
| Molecular Formula | C26H22Cl2N2O |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]isoquinoline-8-carboxamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNC(=O)c1cccc2ccncc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H22Cl2N2O/c1-17(18-5-9-21(27)10-6-18)24(20-7-11-22(28)12-8-20)16-30-26(31)23-4-2-3-19-13-14-29-15-25(19)23/h2-15,17,24H,16H2,1H3,(H,30,31) |
| InChIKey | PLVBFEIIRLVIRF-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |