C23H28Cl2N2O — CID 69352127
N-[2,3-bis(4-chlorophenyl)butyl]-1-methylpiperidine-2-carboxamide (PubChem CID 69352127) has the molecular formula C23H28Cl2N2O and a molecular weight of 419.40 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]-1-methylpiperidine-2-carboxamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]-1-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 69352127 |
| Molecular Formula | C23H28Cl2N2O |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]-1-methylpiperidine-2-carboxamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNC(=O)C1CCCCN1C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H28Cl2N2O/c1-16(17-6-10-19(24)11-7-17)21(18-8-12-20(25)13-9-18)15-26-23(28)22-5-3-4-14-27(22)2/h6-13,16,21-22H,3-5,14-15H2,1-2H3,(H,26,28) |
| InChIKey | QDURKZSGKBOEOY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |