C26H25Cl2NO2 — CID 69456114
N-[2,3-bis(4-chlorophenyl)butyl]-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 69456114) has the molecular formula C26H25Cl2NO2 and a molecular weight of 454.40 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 69456114 |
| Molecular Formula | C26H25Cl2NO2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNC(=O)C1CCc2ccccc2O1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25Cl2NO2/c1-17(18-6-11-21(27)12-7-18)23(19-8-13-22(28)14-9-19)16-29-26(30)25-15-10-20-4-2-3-5-24(20)31-25/h2-9,11-14,17,23,25H,10,15-16H2,1H3,(H,29,30) |
| InChIKey | MRJKQZKRUOCOCP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |