C21H25Cl2NO2 — CID 69145454
N-[2,3-bis(4-chlorophenyl)butyl]-3-hydroxy-2,2-dimethylpropanamide (PubChem CID 69145454) has the molecular formula C21H25Cl2NO2 and a molecular weight of 394.34 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]-3-hydroxy-2,2-dimethylpropanamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]-3-hydroxy-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 69145454 |
| Molecular Formula | C21H25Cl2NO2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]-3-hydroxy-2,2-dimethylpropanamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNC(=O)C(C)(C)CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25Cl2NO2/c1-14(15-4-8-17(22)9-5-15)19(16-6-10-18(23)11-7-16)12-24-20(26)21(2,3)13-25/h4-11,14,19,25H,12-13H2,1-3H3,(H,24,26) |
| InChIKey | ZUFROBFNIOTIOI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |