C26H26Cl2FNO2 — CID 69147591
N-[2,3-bis(4-chlorophenyl)butyl]-2-(3-fluorophenoxy)-2-methylpropanamide (PubChem CID 69147591) has the molecular formula C26H26Cl2FNO2 and a molecular weight of 474.40 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]-2-(3-fluorophenoxy)-2-methylpropanamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]-2-(3-fluorophenoxy)-2-methylpropanamide |
|---|---|
| PubChem CID | 69147591 |
| Molecular Formula | C26H26Cl2FNO2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]-2-(3-fluorophenoxy)-2-methylpropanamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNC(=O)C(C)(C)Oc1cccc(F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H26Cl2FNO2/c1-17(18-7-11-20(27)12-8-18)24(19-9-13-21(28)14-10-19)16-30-25(31)26(2,3)32-23-6-4-5-22(29)15-23/h4-15,17,24H,16H2,1-3H3,(H,30,31) |
| InChIKey | QRMJKJKTGINFGX-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |