C25H26ClFN2O2 — CID 69147345
N-[3-(4-chlorophenyl)-2-pyridin-2-ylbutyl]-2-(4-fluorophenoxy)-2-methylpropanamide (PubChem CID 69147345) has the molecular formula C25H26ClFN2O2 and a molecular weight of 440.95 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-2-pyridin-2-ylbutyl]-2-(4-fluorophenoxy)-2-methylpropanamide.
| Compound Name | N-[3-(4-chlorophenyl)-2-pyridin-2-ylbutyl]-2-(4-fluorophenoxy)-2-methylpropanamide |
|---|---|
| PubChem CID | 69147345 |
| Molecular Formula | C25H26ClFN2O2 |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-[3-(4-chlorophenyl)-2-pyridin-2-ylbutyl]-2-(4-fluorophenoxy)-2-methylpropanamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNC(=O)C(C)(C)Oc1ccc(F)cc1)c1ccccn1 |
| InChI | InChI=1S/C25H26ClFN2O2/c1-17(18-7-9-19(26)10-8-18)22(23-6-4-5-15-28-23)16-29-24(30)25(2,3)31-21-13-11-20(27)12-14-21/h4-15,17,22H,16H2,1-3H3,(H,29,30) |
| InChIKey | ATBBFHVCRHPEIF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |