C19H19ClF3NO3 — CID 60591637
2-(4-chlorophenoxy)-N-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-methylpropanamide (PubChem CID 60591637) has the molecular formula C19H19ClF3NO3 and a molecular weight of 401.81 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 60591637 |
| Molecular Formula | C19H19ClF3NO3 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)NCC(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H19ClF3NO3/c1-18(2,27-13-9-7-12(20)8-10-13)17(26)24-11-16(25)14-5-3-4-6-15(14)19(21,22)23/h3-10,16,25H,11H2,1-2H3,(H,24,26) |
| InChIKey | CUFCWNOMBVGZKD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |