C17H16F3NO3 — CID 94810445
N-[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-phenoxyacetamide (PubChem CID 94810445) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-phenoxyacetamide.
| Compound Name | N-[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 94810445 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC[C@@H](O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H16F3NO3/c18-17(19,20)14-9-5-4-8-13(14)15(22)10-21-16(23)11-24-12-6-2-1-3-7-12/h1-9,15,22H,10-11H2,(H,21,23)/t15-/m1/s1 |
| InChIKey | JIMARDSQZAJAPZ-OAHLLOKOSA-N |
| XLogP | 2.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |