C22H21Cl2NO2S — CID 69331280
N-[2,3-bis(4-chlorophenyl)butyl]benzenesulfonamide (PubChem CID 69331280) has the molecular formula C22H21Cl2NO2S and a molecular weight of 434.39 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]benzenesulfonamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69331280 |
| Molecular Formula | C22H21Cl2NO2S |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]benzenesulfonamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNS(=O)(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21Cl2NO2S/c1-16(17-7-11-19(23)12-8-17)22(18-9-13-20(24)14-10-18)15-25-28(26,27)21-5-3-2-4-6-21/h2-14,16,22,25H,15H2,1H3 |
| InChIKey | HFLAJDTWRIVLQN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |