C27H23ClN2O2S — CID 69343924
N-[3-(4-chlorophenyl)-2-(3-cyanophenyl)butyl]naphthalene-2-sulfonamide (PubChem CID 69343924) has the molecular formula C27H23ClN2O2S and a molecular weight of 475.01 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-2-(3-cyanophenyl)butyl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-(4-chlorophenyl)-2-(3-cyanophenyl)butyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 69343924 |
| Molecular Formula | C27H23ClN2O2S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-[3-(4-chlorophenyl)-2-(3-cyanophenyl)butyl]naphthalene-2-sulfonamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNS(=O)(=O)c1ccc2ccccc2c1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C27H23ClN2O2S/c1-19(21-9-12-25(28)13-10-21)27(24-8-4-5-20(15-24)17-29)18-30-33(31,32)26-14-11-22-6-2-3-7-23(22)16-26/h2-16,19,27,30H,18H2,1H3 |
| InChIKey | LLZSPZSXHALJTO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |