C18H23ClN2O2S — CID 2198405
4-chloro-N-[(2S)-2-(diethylamino)-2-phenylethyl]benzenesulfonamide (PubChem CID 2198405) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-2-(diethylamino)-2-phenylethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2S)-2-(diethylamino)-2-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2198405 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-chloro-N-[(2S)-2-(diethylamino)-2-phenylethyl]benzenesulfonamide |
| SMILES | CCN(CC)[C@H](CNS(=O)(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H23ClN2O2S/c1-3-21(4-2)18(15-8-6-5-7-9-15)14-20-24(22,23)17-12-10-16(19)11-13-17/h5-13,18,20H,3-4,14H2,1-2H3/t18-/m1/s1 |
| InChIKey | PCRMKKMKFBAEKN-GOSISDBHSA-N |
| XLogP | 3.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |