C15H26ClN3O2S — CID 110621877
1-(4-chlorophenyl)-N,N-diethyl-N'-(propylsulfamoyl)ethane-1,2-diamine (PubChem CID 110621877) has the molecular formula C15H26ClN3O2S and a molecular weight of 347.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,N-diethyl-N'-(propylsulfamoyl)ethane-1,2-diamine.
| Compound Name | 1-(4-chlorophenyl)-N,N-diethyl-N'-(propylsulfamoyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 110621877 |
| Molecular Formula | C15H26ClN3O2S |
| Molecular Weight | 347.91 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-(4-chlorophenyl)-N,N-diethyl-N'-(propylsulfamoyl)ethane-1,2-diamine |
| SMILES | CCCNS(=O)(=O)NCC(c1ccc(Cl)cc1)N(CC)CC |
| InChI | InChI=1S/C15H26ClN3O2S/c1-4-11-17-22(20,21)18-12-15(19(5-2)6-3)13-7-9-14(16)10-8-13/h7-10,15,17-18H,4-6,11-12H2,1-3H3 |
| InChIKey | MFXLEVAYJYYIDU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.91 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |