C12H21N3O2S — CID 110620930
N'-(ethylsulfamoyl)-N,N-dimethyl-1-phenylethane-1,2-diamine (PubChem CID 110620930) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is N'-(ethylsulfamoyl)-N,N-dimethyl-1-phenylethane-1,2-diamine.
| Compound Name | N'-(ethylsulfamoyl)-N,N-dimethyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 110620930 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N'-(ethylsulfamoyl)-N,N-dimethyl-1-phenylethane-1,2-diamine |
| SMILES | CCNS(=O)(=O)NCC(c1ccccc1)N(C)C |
| InChI | InChI=1S/C12H21N3O2S/c1-4-13-18(16,17)14-10-12(15(2)3)11-8-6-5-7-9-11/h5-9,12-14H,4,10H2,1-3H3 |
| InChIKey | MKSAFWTUIKHCPU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |