C12H20N2 — CID 134927015
(1S)-N,N,N',N'-tetramethyl-1-phenylethane-1,2-diamine (PubChem CID 134927015) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (1S)-N,N,N',N'-tetramethyl-1-phenylethane-1,2-diamine.
| Compound Name | (1S)-N,N,N',N'-tetramethyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 134927015 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (1S)-N,N,N',N'-tetramethyl-1-phenylethane-1,2-diamine |
| SMILES | CN(C)C[C@H](c1ccccc1)N(C)C |
| InChI | InChI=1S/C12H20N2/c1-13(2)10-12(14(3)4)11-8-6-5-7-9-11/h5-9,12H,10H2,1-4H3/t12-/m1/s1 |
| InChIKey | VRLWWRXSQPYXQP-GFCCVEGCSA-N |
| XLogP | 1.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |