C15H25N — CID 67220027
N,N-dimethyl-1-phenylheptan-1-amine (PubChem CID 67220027) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylheptan-1-amine.
| Compound Name | N,N-dimethyl-1-phenylheptan-1-amine |
|---|---|
| PubChem CID | 67220027 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N,N-dimethyl-1-phenylheptan-1-amine |
| SMILES | CCCCCCC(c1ccccc1)N(C)C |
| InChI | InChI=1S/C15H25N/c1-4-5-6-10-13-15(16(2)3)14-11-8-7-9-12-14/h7-9,11-12,15H,4-6,10,13H2,1-3H3 |
| InChIKey | ZUQFXPQTTZQPPR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|