About 1-phenylheptylphosphane
1-phenylheptylphosphane (PubChem CID 174874892) has the molecular formula C13H21P
and a molecular weight of 208.29 g/mol. Its IUPAC name is 1-phenylheptylphosphane.
Molecular Properties
| Compound Name | 1-phenylheptylphosphane |
| PubChem CID | 174874892 |
| Molecular Formula | C13H21P |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-phenylheptylphosphane |
| SMILES | CCCCCCC(P)c1ccccc1 |
| InChI | InChI=1S/C13H21P/c1-2-3-4-8-11-13(14)12-9-6-5-7-10-12/h5-7,9-10,13H,2-4,8,11,14H2,1H3 |
| InChIKey | YRCMFOLXLUBTOS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylheptylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylheptylphosphane?
The IUPAC name of 1-phenylheptylphosphane (CID 174874892) is 1-phenylheptylphosphane.
What is the SMILES notation for 1-phenylheptylphosphane?
The canonical SMILES for 1-phenylheptylphosphane is CCCCCCC(P)c1ccccc1.
What is the InChIKey of 1-phenylheptylphosphane?
The InChIKey is YRCMFOLXLUBTOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21P/c1-2-3-4-8-11-13(14)12-9-6-5-7-10-12/h5-7,9-10,13H,2-4,8,11,14H2,1H3.
What are the key properties of 1-phenylheptylphosphane?
1-phenylheptylphosphane has a molecular weight of 208.29 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylheptylphosphane is sourced from PubChem (CID 174874892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).