C25H46BrN — CID 173082134
N,N-dimethyl-1-phenylheptadecan-1-amine;hydrobromide (PubChem CID 173082134) has the molecular formula C25H46BrN and a molecular weight of 440.55 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylheptadecan-1-amine;hydrobromide.
| Compound Name | N,N-dimethyl-1-phenylheptadecan-1-amine;hydrobromide |
|---|---|
| PubChem CID | 173082134 |
| Molecular Formula | C25H46BrN |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | N,N-dimethyl-1-phenylheptadecan-1-amine;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCCCCCC(c1ccccc1)N(C)C |
| InChI | InChI=1S/C25H45N.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-25(26(2)3)24-21-18-17-19-22-24;/h17-19,21-22,25H,4-16,20,23H2,1-3H3;1H |
| InChIKey | OEOCZPWMHRQDJA-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|