C21H29N — CID 165348529
N,N-dimethyl-1,3-diphenylheptan-1-amine (PubChem CID 165348529) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is N,N-dimethyl-1,3-diphenylheptan-1-amine.
| Compound Name | N,N-dimethyl-1,3-diphenylheptan-1-amine |
|---|---|
| PubChem CID | 165348529 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N,N-dimethyl-1,3-diphenylheptan-1-amine |
| SMILES | CCCCC(CC(c1ccccc1)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H29N/c1-4-5-12-20(18-13-8-6-9-14-18)17-21(22(2)3)19-15-10-7-11-16-19/h6-11,13-16,20-21H,4-5,12,17H2,1-3H3 |
| InChIKey | GNEWEQZOWGDFNY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |