C17H30ClN — CID 173276058
N,N-dimethyl-1-phenylnonan-1-amine;hydrochloride (PubChem CID 173276058) has the molecular formula C17H30ClN and a molecular weight of 283.89 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylnonan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-1-phenylnonan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 173276058 |
| Molecular Formula | C17H30ClN |
| Molecular Weight | 283.89 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N,N-dimethyl-1-phenylnonan-1-amine;hydrochloride |
| SMILES | CCCCCCCCC(c1ccccc1)N(C)C.Cl |
| InChI | InChI=1S/C17H29N.ClH/c1-4-5-6-7-8-12-15-17(18(2)3)16-13-10-9-11-14-16;/h9-11,13-14,17H,4-8,12,15H2,1-3H3;1H |
| InChIKey | TXUDFTJIRBLVBJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.89 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|