C19H34BrN — CID 175211011
N,N-diethyl-1-phenylnonan-1-amine;hydrobromide (PubChem CID 175211011) has the molecular formula C19H34BrN and a molecular weight of 356.39 g/mol. Its IUPAC name is N,N-diethyl-1-phenylnonan-1-amine;hydrobromide.
| Compound Name | N,N-diethyl-1-phenylnonan-1-amine;hydrobromide |
|---|---|
| PubChem CID | 175211011 |
| Molecular Formula | C19H34BrN |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N,N-diethyl-1-phenylnonan-1-amine;hydrobromide |
| SMILES | Br.CCCCCCCCC(c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C19H33N.BrH/c1-4-7-8-9-10-14-17-19(20(5-2)6-3)18-15-12-11-13-16-18;/h11-13,15-16,19H,4-10,14,17H2,1-3H3;1H |
| InChIKey | PNHWBMWLFDXIDU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|