C21H34N2 — CID 90025073
N,N-diethyl-1-(1H-indol-3-yl)nonan-1-amine (PubChem CID 90025073) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is N,N-diethyl-1-(1H-indol-3-yl)nonan-1-amine.
| Compound Name | N,N-diethyl-1-(1H-indol-3-yl)nonan-1-amine |
|---|---|
| PubChem CID | 90025073 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | N,N-diethyl-1-(1H-indol-3-yl)nonan-1-amine |
| SMILES | CCCCCCCCC(c1c[nH]c2ccccc12)N(CC)CC |
| InChI | InChI=1S/C21H34N2/c1-4-7-8-9-10-11-16-21(23(5-2)6-3)19-17-22-20-15-13-12-14-18(19)20/h12-15,17,21-22H,4-11,16H2,1-3H3 |
| InChIKey | JIGNQWVUQJWOKA-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|