C24H44BrN — CID 175213976
N,N-diethyl-1-phenyltetradecan-1-amine;hydrobromide (PubChem CID 175213976) has the molecular formula C24H44BrN and a molecular weight of 426.53 g/mol. Its IUPAC name is N,N-diethyl-1-phenyltetradecan-1-amine;hydrobromide.
| Compound Name | N,N-diethyl-1-phenyltetradecan-1-amine;hydrobromide |
|---|---|
| PubChem CID | 175213976 |
| Molecular Formula | C24H44BrN |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N,N-diethyl-1-phenyltetradecan-1-amine;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCCC(c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C24H43N.BrH/c1-4-7-8-9-10-11-12-13-14-15-19-22-24(25(5-2)6-3)23-20-17-16-18-21-23;/h16-18,20-21,24H,4-15,19,22H2,1-3H3;1H |
| InChIKey | UUGLTNOHEUCUQS-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|