About N-ethyl-N-methylethanamine;1-phenylheptylbenzene
N-ethyl-N-methylethanamine;1-phenylheptylbenzene (PubChem CID 18402602) has the molecular formula C24H37N
and a molecular weight of 339.57 g/mol. Its IUPAC name is N-ethyl-N-methylethanamine;1-phenylheptylbenzene.
Molecular Properties
| Compound Name | N-ethyl-N-methylethanamine;1-phenylheptylbenzene |
| PubChem CID | 18402602 |
| Molecular Formula | C24H37N |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | N-ethyl-N-methylethanamine;1-phenylheptylbenzene |
| SMILES | CCCCCCC(c1ccccc1)c1ccccc1.CCN(C)CC |
| InChI | InChI=1S/C19H24.C5H13N/c1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18;1-4-6(3)5-2/h5-10,12-15,19H,2-4,11,16H2,1H3;4-5H2,1-3H3 |
| InChIKey | LKGVEFNMHNQTDD-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methylethanamine;1-phenylheptylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylethanamine;1-phenylheptylbenzene?
The IUPAC name of N-ethyl-N-methylethanamine;1-phenylheptylbenzene (CID 18402602) is N-ethyl-N-methylethanamine;1-phenylheptylbenzene.
What is the SMILES notation for N-ethyl-N-methylethanamine;1-phenylheptylbenzene?
The canonical SMILES for N-ethyl-N-methylethanamine;1-phenylheptylbenzene is CCCCCCC(c1ccccc1)c1ccccc1.CCN(C)CC.
What is the InChIKey of N-ethyl-N-methylethanamine;1-phenylheptylbenzene?
The InChIKey is LKGVEFNMHNQTDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24.C5H13N/c1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18;1-4-6(3)5-2/h5-10,12-15,19H,2-4,11,16H2,1H3;4-5H2,1-3H3.
What are the key properties of N-ethyl-N-methylethanamine;1-phenylheptylbenzene?
N-ethyl-N-methylethanamine;1-phenylheptylbenzene has a molecular weight of 339.57 g/mol, XLogP of 6.75, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylethanamine;1-phenylheptylbenzene is sourced from PubChem (CID 18402602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).