C13H23N — CID 144553481
N,N-dimethyl-1-phenylpropan-1-amine;ethane (PubChem CID 144553481) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylpropan-1-amine;ethane.
| Compound Name | N,N-dimethyl-1-phenylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 144553481 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N,N-dimethyl-1-phenylpropan-1-amine;ethane |
| SMILES | CC.CCC(c1ccccc1)N(C)C |
| InChI | InChI=1S/C11H17N.C2H6/c1-4-11(12(2)3)10-8-6-5-7-9-10;1-2/h5-9,11H,4H2,1-3H3;1-2H3 |
| InChIKey | KEWRYPKXJJZDRD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |