C11H17N3O3 — CID 65442025
methyl 2-acetamido-3-(3,5-dimethylpyrazol-1-yl)propanoate (PubChem CID 65442025) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3,5-dimethylpyrazol-1-yl)propanoate.
| Compound Name | methyl 2-acetamido-3-(3,5-dimethylpyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 65442025 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | methyl 2-acetamido-3-(3,5-dimethylpyrazol-1-yl)propanoate |
| SMILES | COC(=O)C(Cn1nc(C)cc1C)NC(C)=O |
| InChI | InChI=1S/C11H17N3O3/c1-7-5-8(2)14(13-7)6-10(11(16)17-4)12-9(3)15/h5,10H,6H2,1-4H3,(H,12,15) |
| InChIKey | KZMDXAZAOFQBIY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |