C9H13F3N2O — CID 63811735
3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole (PubChem CID 63811735) has the molecular formula C9H13F3N2O and a molecular weight of 222.21 g/mol. Its IUPAC name is 3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole.
| Compound Name | 3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole |
|---|---|
| PubChem CID | 63811735 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole |
| SMILES | Cc1cc(C)n(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H13F3N2O/c1-7-5-8(2)14(13-7)3-4-15-6-9(10,11)12/h5H,3-4,6H2,1-2H3 |
| InChIKey | PRNRWUFECJROQQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|