C9H15F3N4O2 — CID 162603600
amino-[4-amino-3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-5-yl]methanol (PubChem CID 162603600) has the molecular formula C9H15F3N4O2 and a molecular weight of 268.24 g/mol. Its IUPAC name is amino-[4-amino-3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-5-yl]methanol.
| Compound Name | amino-[4-amino-3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 162603600 |
| Molecular Formula | C9H15F3N4O2 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | amino-[4-amino-3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-5-yl]methanol |
| SMILES | Cc1nn(CCOCC(F)(F)F)c(C(N)O)c1N |
| InChI | InChI=1S/C9H15F3N4O2/c1-5-6(13)7(8(14)17)16(15-5)2-3-18-4-9(10,11)12/h8,17H,2-4,13-14H2,1H3 |
| InChIKey | AREFDCYIYJYENG-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|