C6H8BrF3N4O — CID 103098728
5-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-amine (PubChem CID 103098728) has the molecular formula C6H8BrF3N4O and a molecular weight of 289.06 g/mol. Its IUPAC name is 5-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-amine.
| Compound Name | 5-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 103098728 |
| Molecular Formula | C6H8BrF3N4O |
| Molecular Weight | 289.06 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 5-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-amine |
| SMILES | Nc1nc(Br)n(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C6H8BrF3N4O/c7-4-12-5(11)13-14(4)1-2-15-3-6(8,9)10/h1-3H2,(H2,11,13) |
| InChIKey | JUSSPEGTOOASBT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.06 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|