C7H13BrN4O — CID 106452735
5-bromo-1-(2-propoxyethyl)-1,2,4-triazol-3-amine (PubChem CID 106452735) has the molecular formula C7H13BrN4O and a molecular weight of 249.11 g/mol. Its IUPAC name is 5-bromo-1-(2-propoxyethyl)-1,2,4-triazol-3-amine.
| Compound Name | 5-bromo-1-(2-propoxyethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 106452735 |
| Molecular Formula | C7H13BrN4O |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 5-bromo-1-(2-propoxyethyl)-1,2,4-triazol-3-amine |
| SMILES | CCCOCCn1nc(N)nc1Br |
| InChI | InChI=1S/C7H13BrN4O/c1-2-4-13-5-3-12-6(8)10-7(9)11-12/h2-5H2,1H3,(H2,9,11) |
| InChIKey | USJZPVBXUSMLDN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|